C18H14ClF3N2O3 — CID 16511712
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-cyano-2-methoxyphenoxy)propanamide (PubChem CID 16511712) has the molecular formula C18H14ClF3N2O3 and a molecular weight of 398.77 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-cyano-2-methoxyphenoxy)propanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-cyano-2-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 16511712 |
| Molecular Formula | C18H14ClF3N2O3 |
| Molecular Weight | 398.77 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-cyano-2-methoxyphenoxy)propanamide |
| SMILES | COc1cc(C#N)ccc1OC(C)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14ClF3N2O3/c1-10(27-15-6-3-11(9-23)7-16(15)26-2)17(25)24-12-4-5-14(19)13(8-12)18(20,21)22/h3-8,10H,1-2H3,(H,24,25) |
| InChIKey | JHDRCZWLPGBMSK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |