C20H22F3N3O3 — CID 165118503
[5-(2-aminoethyl)-2-[[4-(3-aminopropyl)phenyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 165118503) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is [5-(2-aminoethyl)-2-[[4-(3-aminopropyl)phenyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-(2-aminoethyl)-2-[[4-(3-aminopropyl)phenyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165118503 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [5-(2-aminoethyl)-2-[[4-(3-aminopropyl)phenyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | NCCCc1ccc(NC(=O)c2ccc(CCN)cc2OC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3N3O3/c21-20(22,23)19(28)29-17-12-14(9-11-25)5-8-16(17)18(27)26-15-6-3-13(4-7-15)2-1-10-24/h3-8,12H,1-2,9-11,24-25H2,(H,26,27) |
| InChIKey | YWWRXUYTWIGACY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|