C12H13NO2 — CID 165119310
(1S,5S,6S)-N-phenyl-2-oxabicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 165119310) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (1S,5S,6S)-N-phenyl-2-oxabicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | (1S,5S,6S)-N-phenyl-2-oxabicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 165119310 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (1S,5S,6S)-N-phenyl-2-oxabicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C12H13NO2/c14-12(10-9-6-7-15-11(9)10)13-8-4-2-1-3-5-8/h1-5,9-11H,6-7H2,(H,13,14)/t9-,10-,11-/m0/s1 |
| InChIKey | AOCXUYFDUZBQBH-DCAQKATOSA-N |
| XLogP | 1.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |