C28H38N4O3 — CID 165121366
(3R)-3-(5-cyclopropyl-3-pyridinyl)-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid (PubChem CID 165121366) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is (3R)-3-(5-cyclopropyl-3-pyridinyl)-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid.
| Compound Name | (3R)-3-(5-cyclopropyl-3-pyridinyl)-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 165121366 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (3R)-3-(5-cyclopropyl-3-pyridinyl)-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid |
| SMILES | O=C(O)C[C@@H](CO[C@@H]1CCCN(CCCc2ccc3c(n2)NCCC3)C1)c1cncc(C2CC2)c1 |
| InChI | InChI=1S/C28H38N4O3/c33-27(34)15-24(23-14-22(16-29-17-23)20-7-8-20)19-35-26-6-3-13-32(18-26)12-2-5-25-10-9-21-4-1-11-30-28(21)31-25/h9-10,14,16-17,20,24,26H,1-8,11-13,15,18-19H2,(H,30,31)(H,33,34)/t24-,26+/m0/s1 |
| InChIKey | OVBVTXNXCBNVBI-AZGAKELHSA-N |
| XLogP | 4.38 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |