C32H45FN4O4 — CID 165121646
(3S)-3-[3-(2,2-dimethylmorpholin-4-yl)-4-fluorophenyl]-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid (PubChem CID 165121646) has the molecular formula C32H45FN4O4 and a molecular weight of 568.73 g/mol. Its IUPAC name is (3S)-3-[3-(2,2-dimethylmorpholin-4-yl)-4-fluorophenyl]-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid.
| Compound Name | (3S)-3-[3-(2,2-dimethylmorpholin-4-yl)-4-fluorophenyl]-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 165121646 |
| Molecular Formula | C32H45FN4O4 |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | (3S)-3-[3-(2,2-dimethylmorpholin-4-yl)-4-fluorophenyl]-4-[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-3-yl]oxybutanoic acid |
| SMILES | CC1(C)CN(c2cc([C@@H](CO[C@@H]3CCCN(CCCc4ccc5c(n4)NCCC5)C3)CC(=O)O)ccc2F)CCO1 |
| InChI | InChI=1S/C32H45FN4O4/c1-32(2)22-37(16-17-41-32)29-18-24(10-12-28(29)33)25(19-30(38)39)21-40-27-8-5-15-36(20-27)14-4-7-26-11-9-23-6-3-13-34-31(23)35-26/h9-12,18,25,27H,3-8,13-17,19-22H2,1-2H3,(H,34,35)(H,38,39)/t25-,27-/m1/s1 |
| InChIKey | STOXKWXSEZCPRI-XNMGPUDCSA-N |
| XLogP | 4.87 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |