C18H19N2OP — CID 165123425
3-[(6-dimethylphosphanylquinolin-4-yl)amino]-4-methylphenol (PubChem CID 165123425) has the molecular formula C18H19N2OP and a molecular weight of 310.34 g/mol. Its IUPAC name is 3-[(6-dimethylphosphanylquinolin-4-yl)amino]-4-methylphenol.
| Compound Name | 3-[(6-dimethylphosphanylquinolin-4-yl)amino]-4-methylphenol |
|---|---|
| PubChem CID | 165123425 |
| Molecular Formula | C18H19N2OP |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-[(6-dimethylphosphanylquinolin-4-yl)amino]-4-methylphenol |
| SMILES | Cc1ccc(O)cc1Nc1ccnc2ccc(P(C)C)cc12 |
| InChI | InChI=1S/C18H19N2OP/c1-12-4-5-13(21)10-18(12)20-17-8-9-19-16-7-6-14(22(2)3)11-15(16)17/h4-11,21H,1-3H3,(H,19,20) |
| InChIKey | TURZAJRSLUPNMB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|