C20H21N3O4S — CID 54672856
4-(5-hydroxy-2-methylanilino)-N-(2-methylsulfonylethyl)quinoline-6-carboxamide (PubChem CID 54672856) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-(5-hydroxy-2-methylanilino)-N-(2-methylsulfonylethyl)quinoline-6-carboxamide.
| Compound Name | 4-(5-hydroxy-2-methylanilino)-N-(2-methylsulfonylethyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 54672856 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-(5-hydroxy-2-methylanilino)-N-(2-methylsulfonylethyl)quinoline-6-carboxamide |
| SMILES | Cc1ccc(O)cc1Nc1ccnc2ccc(C(=O)NCCS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C20H21N3O4S/c1-13-3-5-15(24)12-19(13)23-18-7-8-21-17-6-4-14(11-16(17)18)20(25)22-9-10-28(2,26)27/h3-8,11-12,24H,9-10H2,1-2H3,(H,21,23)(H,22,25) |
| InChIKey | JKJLDPQFNAMZGO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |