C30H31ClN6O3 — CID 165124528
(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-methoxyquinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide (PubChem CID 165124528) has the molecular formula C30H31ClN6O3 and a molecular weight of 559.07 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-methoxyquinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-methoxyquinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 165124528 |
| Molecular Formula | C30H31ClN6O3 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-methoxyquinazolin-6-yl]-4-piperidin-1-ylbut-2-enamide |
| SMILES | COc1c(NC(=O)/C=C/CN2CCCCC2)ccc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c12 |
| InChI | InChI=1S/C30H31ClN6O3/c1-39-29-25(36-27(38)9-7-17-37-15-5-2-6-16-37)12-11-24-28(29)30(34-20-33-24)35-21-10-13-26(23(31)18-21)40-19-22-8-3-4-14-32-22/h3-4,7-14,18,20H,2,5-6,15-17,19H2,1H3,(H,36,38)(H,33,34,35)/b9-7+ |
| InChIKey | NNOKZYXIFIFASR-VQHVLOKHSA-N |
| XLogP | 5.99 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|