C32H33ClN6O3 — CID 174199009
(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-cyclobutyloxyquinazolin-6-yl]-3-(1-methylpyrrolidin-2-yl)prop-2-enamide (PubChem CID 174199009) has the molecular formula C32H33ClN6O3 and a molecular weight of 585.11 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-cyclobutyloxyquinazolin-6-yl]-3-(1-methylpyrrolidin-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-cyclobutyloxyquinazolin-6-yl]-3-(1-methylpyrrolidin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 174199009 |
| Molecular Formula | C32H33ClN6O3 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-5-cyclobutyloxyquinazolin-6-yl]-3-(1-methylpyrrolidin-2-yl)prop-2-enamide |
| SMILES | CN1CCCC1/C=C/C(=O)Nc1ccc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2c1OC1CCC1 |
| InChI | InChI=1S/C32H33ClN6O3/c1-39-17-5-7-23(39)11-15-29(40)38-27-13-12-26-30(31(27)42-24-8-4-9-24)32(36-20-35-26)37-21-10-14-28(25(33)18-21)41-19-22-6-2-3-16-34-22/h2-3,6,10-16,18,20,23-24H,4-5,7-9,17,19H2,1H3,(H,38,40)(H,35,36,37)/b15-11+ |
| InChIKey | OEKDOWZGDIUELV-RVDMUPIBSA-N |
| XLogP | 6.52 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|