C25H27NO4 — CID 165124818
benzyl 2-[(2R)-2-amino-3-phenylpropoxy]-6-ethoxybenzoate (PubChem CID 165124818) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is benzyl 2-[(2R)-2-amino-3-phenylpropoxy]-6-ethoxybenzoate.
| Compound Name | benzyl 2-[(2R)-2-amino-3-phenylpropoxy]-6-ethoxybenzoate |
|---|---|
| PubChem CID | 165124818 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | benzyl 2-[(2R)-2-amino-3-phenylpropoxy]-6-ethoxybenzoate |
| SMILES | CCOc1cccc(OC[C@H](N)Cc2ccccc2)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO4/c1-2-28-22-14-9-15-23(29-18-21(26)16-19-10-5-3-6-11-19)24(22)25(27)30-17-20-12-7-4-8-13-20/h3-15,21H,2,16-18,26H2,1H3/t21-/m1/s1 |
| InChIKey | KHEUXDVVAVXOBF-OAQYLSRUSA-N |
| XLogP | 4.39 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |