C19H19NO4 — CID 174203993
6-(2-amino-3-phenylpropoxy)-2-methyl-1-benzofuran-7-carboxylic acid (PubChem CID 174203993) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 6-(2-amino-3-phenylpropoxy)-2-methyl-1-benzofuran-7-carboxylic acid.
| Compound Name | 6-(2-amino-3-phenylpropoxy)-2-methyl-1-benzofuran-7-carboxylic acid |
|---|---|
| PubChem CID | 174203993 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 6-(2-amino-3-phenylpropoxy)-2-methyl-1-benzofuran-7-carboxylic acid |
| SMILES | Cc1cc2ccc(OCC(N)Cc3ccccc3)c(C(=O)O)c2o1 |
| InChI | InChI=1S/C19H19NO4/c1-12-9-14-7-8-16(17(19(21)22)18(14)24-12)23-11-15(20)10-13-5-3-2-4-6-13/h2-9,15H,10-11,20H2,1H3,(H,21,22) |
| InChIKey | PRRWNITZJHTYOO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |