C32H44ClN3O2 — CID 165125692
4-chloro-1-methoxy-2-propylbenzene;6-(1-imino-3-methylbut-2-en-2-yl)-3-methanimidoyl-4-methyl-1H-pyridin-2-one;(Z)-7-methylnon-5-en-3-yne (PubChem CID 165125692) has the molecular formula C32H44ClN3O2 and a molecular weight of 538.18 g/mol. Its IUPAC name is 4-chloro-1-methoxy-2-propylbenzene;6-(1-imino-3-methylbut-2-en-2-yl)-3-methanimidoyl-4-methyl-1H-pyridin-2-one;(Z)-7-methylnon-5-en-3-yne.
| Compound Name | 4-chloro-1-methoxy-2-propylbenzene;6-(1-imino-3-methylbut-2-en-2-yl)-3-methanimidoyl-4-methyl-1H-pyridin-2-one;(Z)-7-methylnon-5-en-3-yne |
|---|---|
| PubChem CID | 165125692 |
| Molecular Formula | C32H44ClN3O2 |
| Molecular Weight | 538.18 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 4-chloro-1-methoxy-2-propylbenzene;6-(1-imino-3-methylbut-2-en-2-yl)-3-methanimidoyl-4-methyl-1H-pyridin-2-one;(Z)-7-methylnon-5-en-3-yne |
| SMILES | CCC#C/C=C\C(C)CC.CCCc1cc(Cl)ccc1OC.[H]/N=C/C(=C(C)C)c1cc(C)c(/C=N/[H])c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N3O.C10H13ClO.C10H16/c1-7(2)9(5-13)11-4-8(3)10(6-14)12(16)15-11;1-3-4-8-7-9(11)5-6-10(8)12-2;1-4-6-7-8-9-10(3)5-2/h4-6,13-14H,1-3H3,(H,15,16);5-7H,3-4H2,1-2H3;8-10H,4-5H2,1-3H3/b13-5+,14-6+;;9-8- |
| InChIKey | DJYWBEABGGXPAP-DTDLUHHFSA-N |
| XLogP | 8.43 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.18 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|