C20H21IN6O2 — CID 165126430
N-[[4-(4-iodo-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-5-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 165126430) has the molecular formula C20H21IN6O2 and a molecular weight of 504.33 g/mol. Its IUPAC name is N-[[4-(4-iodo-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-5-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[[4-(4-iodo-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-5-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165126430 |
| Molecular Formula | C20H21IN6O2 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-[[4-(4-iodo-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-5-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | COc1ccn2nc(C)c(C(=O)NCc3ccc(N4CCN(I)C=N4)cc3)c2c1 |
| InChI | InChI=1S/C20H21IN6O2/c1-14-19(18-11-17(29-2)7-8-27(18)24-14)20(28)22-12-15-3-5-16(6-4-15)26-10-9-25(21)13-23-26/h3-8,11,13H,9-10,12H2,1-2H3,(H,22,28) |
| InChIKey | OFNAHTPBIITLAU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|