C24H23ClN2O7S2 — CID 165130238
5-chloro-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxopropanoyl)phenyl]thiophene-2-carboxamide (PubChem CID 165130238) has the molecular formula C24H23ClN2O7S2 and a molecular weight of 551.04 g/mol. Its IUPAC name is 5-chloro-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxopropanoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxopropanoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 165130238 |
| Molecular Formula | C24H23ClN2O7S2 |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 5-chloro-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxopropanoyl)phenyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccc(N(C)S(=O)(=O)c2cc(Cl)sc2C(=O)Nc2cccc(C(=O)C(C)=O)c2)cc1OC |
| InChI | InChI=1S/C24H23ClN2O7S2/c1-5-34-18-10-9-17(12-19(18)33-4)27(3)36(31,32)20-13-21(25)35-23(20)24(30)26-16-8-6-7-15(11-16)22(29)14(2)28/h6-13H,5H2,1-4H3,(H,26,30) |
| InChIKey | YYLPSIFVICGUIV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|