C23H20ClN3O7S2 — CID 165130279
5-chloro-N-(1,3-dioxoisoindol-5-yl)-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]thiophene-2-carboxamide (PubChem CID 165130279) has the molecular formula C23H20ClN3O7S2 and a molecular weight of 550.01 g/mol. Its IUPAC name is 5-chloro-N-(1,3-dioxoisoindol-5-yl)-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(1,3-dioxoisoindol-5-yl)-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 165130279 |
| Molecular Formula | C23H20ClN3O7S2 |
| Molecular Weight | 550.01 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | 5-chloro-N-(1,3-dioxoisoindol-5-yl)-3-[(4-ethoxy-3-methoxyphenyl)-methylsulfamoyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccc(N(C)S(=O)(=O)c2cc(Cl)sc2C(=O)Nc2ccc3c(c2)C(=O)NC3=O)cc1OC |
| InChI | InChI=1S/C23H20ClN3O7S2/c1-4-34-16-8-6-13(10-17(16)33-3)27(2)36(31,32)18-11-19(24)35-20(18)23(30)25-12-5-7-14-15(9-12)22(29)26-21(14)28/h5-11H,4H2,1-3H3,(H,25,30)(H,26,28,29) |
| InChIKey | QLAYLCDHJCLVJE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.01 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|