C24H21ClN2O5 — CID 16513072
(2-chloro-7-methoxyquinolin-3-yl)methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate (PubChem CID 16513072) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is (2-chloro-7-methoxyquinolin-3-yl)methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate.
| Compound Name | (2-chloro-7-methoxyquinolin-3-yl)methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 16513072 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (2-chloro-7-methoxyquinolin-3-yl)methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
| SMILES | COc1ccc2cc(COC(=O)c3ccccc3OCc3c(C)noc3C)c(Cl)nc2c1 |
| InChI | InChI=1S/C24H21ClN2O5/c1-14-20(15(2)32-27-14)13-30-22-7-5-4-6-19(22)24(28)31-12-17-10-16-8-9-18(29-3)11-21(16)26-23(17)25/h4-11H,12-13H2,1-3H3 |
| InChIKey | HWAJAODVYGEZMX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|