C22H30ClNO6 — CID 165133313
ethyl (2S)-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-chlorophenyl]cyclopropane-1-carboxylate (PubChem CID 165133313) has the molecular formula C22H30ClNO6 and a molecular weight of 439.94 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-chlorophenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl (2S)-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-chlorophenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 165133313 |
| Molecular Formula | C22H30ClNO6 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | ethyl (2S)-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-chlorophenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H]1c1ccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C22H30ClNO6/c1-8-28-18(25)15-12-14(15)13-9-10-17(16(23)11-13)24(19(26)29-21(2,3)4)20(27)30-22(5,6)7/h9-11,14-15H,8,12H2,1-7H3/t14-,15?/m1/s1 |
| InChIKey | MITAVKUATOIOJX-GICMACPYSA-N |
| XLogP | 5.68 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|