C21H18FN5O5 — CID 165133402
1-[6-cyclopropyl-2-[(2-fluoro-5-nitrophenoxy)methyl]imidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione (PubChem CID 165133402) has the molecular formula C21H18FN5O5 and a molecular weight of 439.40 g/mol. Its IUPAC name is 1-[6-cyclopropyl-2-[(2-fluoro-5-nitrophenoxy)methyl]imidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 1-[6-cyclopropyl-2-[(2-fluoro-5-nitrophenoxy)methyl]imidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 165133402 |
| Molecular Formula | C21H18FN5O5 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-[6-cyclopropyl-2-[(2-fluoro-5-nitrophenoxy)methyl]imidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(c2cc(C3CC3)cn3cc(COc4cc([N+](=O)[O-])ccc4F)nc23)C1=O |
| InChI | InChI=1S/C21H18FN5O5/c1-24-19(28)10-26(21(24)29)17-6-13(12-2-3-12)8-25-9-14(23-20(17)25)11-32-18-7-15(27(30)31)4-5-16(18)22/h4-9,12H,2-3,10-11H2,1H3 |
| InChIKey | DOPZCESBTUNRKP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|