C14H10ClN3O3 — CID 4806396
6-chloro-2-[(4-nitrophenoxy)methyl]imidazo[1,2-a]pyridine (PubChem CID 4806396) has the molecular formula C14H10ClN3O3 and a molecular weight of 303.71 g/mol. Its IUPAC name is 6-chloro-2-[(4-nitrophenoxy)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-2-[(4-nitrophenoxy)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 4806396 |
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 6-chloro-2-[(4-nitrophenoxy)methyl]imidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1ccc(OCc2cn3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C14H10ClN3O3/c15-10-1-6-14-16-11(8-17(14)7-10)9-21-13-4-2-12(3-5-13)18(19)20/h1-8H,9H2 |
| InChIKey | AZQDTYORHRPFMY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|