C15H10ClN3O — CID 26218203
4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]benzonitrile (PubChem CID 26218203) has the molecular formula C15H10ClN3O and a molecular weight of 283.72 g/mol. Its IUPAC name is 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]benzonitrile.
| Compound Name | 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 26218203 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCc2cn3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C15H10ClN3O/c16-12-3-6-15-18-13(9-19(15)8-12)10-20-14-4-1-11(7-17)2-5-14/h1-6,8-9H,10H2 |
| InChIKey | XIKQQZAQCRLYQO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |