About 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine
1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine (PubChem CID 106485994) has the molecular formula C16H16ClN3O
and a molecular weight of 301.78 g/mol. Its IUPAC name is 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine |
| PubChem CID | 106485994 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine |
| SMILES | CNCc1cccc(OCc2cn3cc(Cl)ccc3n2)c1 |
| InChI | InChI=1S/C16H16ClN3O/c1-18-8-12-3-2-4-15(7-12)21-11-14-10-20-9-13(17)5-6-16(20)19-14/h2-7,9-10,18H,8,11H2,1H3 |
| InChIKey | LZSMEACWJANRTJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine?
The IUPAC name of 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine (CID 106485994) is 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine.
What is the SMILES notation for 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine?
The canonical SMILES for 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine is CNCc1cccc(OCc2cn3cc(Cl)ccc3n2)c1.
What is the InChIKey of 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine?
The InChIKey is LZSMEACWJANRTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O/c1-18-8-12-3-2-4-15(7-12)21-11-14-10-20-9-13(17)5-6-16(20)19-14/h2-7,9-10,18H,8,11H2,1H3.
What are the key properties of 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine?
1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine has a molecular weight of 301.78 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-N-methylmethanamine is sourced from PubChem (CID 106485994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).