C14H17ClO5 — CID 165133464
ethyl 2-(4-chloro-2-cyclopropylphenoxy)acetate;formic acid (PubChem CID 165133464) has the molecular formula C14H17ClO5 and a molecular weight of 300.74 g/mol. Its IUPAC name is ethyl 2-(4-chloro-2-cyclopropylphenoxy)acetate;formic acid.
| Compound Name | ethyl 2-(4-chloro-2-cyclopropylphenoxy)acetate;formic acid |
|---|---|
| PubChem CID | 165133464 |
| Molecular Formula | C14H17ClO5 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | ethyl 2-(4-chloro-2-cyclopropylphenoxy)acetate;formic acid |
| SMILES | CCOC(=O)COc1ccc(Cl)cc1C1CC1.O=CO |
| InChI | InChI=1S/C13H15ClO3.CH2O2/c1-2-16-13(15)8-17-12-6-5-10(14)7-11(12)9-3-4-9;2-1-3/h5-7,9H,2-4,8H2,1H3;1H,(H,2,3) |
| InChIKey | WAFMDYRJCYABQB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|