C13H14ClN5O — CID 165133484
N-(6-chloropyrimidin-4-yl)cyclopropanecarboxamide;4-methylpyrimidine (PubChem CID 165133484) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is N-(6-chloropyrimidin-4-yl)cyclopropanecarboxamide;4-methylpyrimidine.
| Compound Name | N-(6-chloropyrimidin-4-yl)cyclopropanecarboxamide;4-methylpyrimidine |
|---|---|
| PubChem CID | 165133484 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-(6-chloropyrimidin-4-yl)cyclopropanecarboxamide;4-methylpyrimidine |
| SMILES | Cc1ccncn1.O=C(Nc1cc(Cl)ncn1)C1CC1 |
| InChI | InChI=1S/C8H8ClN3O.C5H6N2/c9-6-3-7(11-4-10-6)12-8(13)5-1-2-5;1-5-2-3-6-4-7-5/h3-5H,1-2H2,(H,10,11,12,13);2-4H,1H3 |
| InChIKey | SEYQRSRTWPCDHT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |