C17H17N5O4S — CID 165134449
4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-nitrobenzenesulfonamide (PubChem CID 165134449) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is 4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-nitrobenzenesulfonamide.
| Compound Name | 4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 165134449 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCc2cn3cc(C4CC4)ccc3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N5O4S/c18-27(25,26)16-5-4-13(7-15(16)22(23)24)19-8-14-10-21-9-12(11-1-2-11)3-6-17(21)20-14/h3-7,9-11,19H,1-2,8H2,(H2,18,25,26) |
| InChIKey | ILAHRZGSERJIBT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|