C23H24ClN5O8S — CID 175521496
tert-butyl N-[5-chloro-4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyloxy]-2-nitrophenyl]sulfonylcarbamate (PubChem CID 175521496) has the molecular formula C23H24ClN5O8S and a molecular weight of 565.99 g/mol. Its IUPAC name is tert-butyl N-[5-chloro-4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyloxy]-2-nitrophenyl]sulfonylcarbamate.
| Compound Name | tert-butyl N-[5-chloro-4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyloxy]-2-nitrophenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 175521496 |
| Molecular Formula | C23H24ClN5O8S |
| Molecular Weight | 565.99 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | tert-butyl N-[5-chloro-4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyloxy]-2-nitrophenyl]sulfonylcarbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)c1cc(Cl)c(OC(=O)NCc2cn3cc(C4CC4)ccc3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24ClN5O8S/c1-23(2,3)37-22(31)27-38(34,35)19-8-16(24)18(9-17(19)29(32)33)36-21(30)25-10-15-12-28-11-14(13-4-5-13)6-7-20(28)26-15/h6-9,11-13H,4-5,10H2,1-3H3,(H,25,30)(H,27,31) |
| InChIKey | JDLHMXIZQNLYBC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 171.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.99 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|