C27H41N3O4 — CID 171549687
tert-butyl N-[2-[4-(2-cyclopropyl-6-methyl-5-nitro-3-pyridinyl)phenyl]propyl]carbamate;ethane (PubChem CID 171549687) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(2-cyclopropyl-6-methyl-5-nitro-3-pyridinyl)phenyl]propyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[4-(2-cyclopropyl-6-methyl-5-nitro-3-pyridinyl)phenyl]propyl]carbamate;ethane |
|---|---|
| PubChem CID | 171549687 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | tert-butyl N-[2-[4-(2-cyclopropyl-6-methyl-5-nitro-3-pyridinyl)phenyl]propyl]carbamate;ethane |
| SMILES | CC.CC.Cc1nc(C2CC2)c(-c2ccc(C(C)CNC(=O)OC(C)(C)C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H29N3O4.2C2H6/c1-14(13-24-22(27)30-23(3,4)5)16-6-8-17(9-7-16)19-12-20(26(28)29)15(2)25-21(19)18-10-11-18;2*1-2/h6-9,12,14,18H,10-11,13H2,1-5H3,(H,24,27);2*1-2H3 |
| InChIKey | FIUGMYMSUFICBB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|