C11H19N3 — CID 165134545
1,5-bis(ethenyl)-3-propan-2-yl-1,2,4-triazole;ethane (PubChem CID 165134545) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1,5-bis(ethenyl)-3-propan-2-yl-1,2,4-triazole;ethane.
| Compound Name | 1,5-bis(ethenyl)-3-propan-2-yl-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 165134545 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1,5-bis(ethenyl)-3-propan-2-yl-1,2,4-triazole;ethane |
| SMILES | C=Cc1nc(C(C)C)nn1C=C.CC |
| InChI | InChI=1S/C9H13N3.C2H6/c1-5-8-10-9(7(3)4)11-12(8)6-2;1-2/h5-7H,1-2H2,3-4H3;1-2H3 |
| InChIKey | DPMLCANVNQEDNH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |