C15H21F3N4 — CID 165134897
4-(piperidin-1-ylmethyl)-N'-(2,2,2-trifluoroethylamino)benzenecarboximidamide (PubChem CID 165134897) has the molecular formula C15H21F3N4 and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-(piperidin-1-ylmethyl)-N'-(2,2,2-trifluoroethylamino)benzenecarboximidamide.
| Compound Name | 4-(piperidin-1-ylmethyl)-N'-(2,2,2-trifluoroethylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 165134897 |
| Molecular Formula | C15H21F3N4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-(piperidin-1-ylmethyl)-N'-(2,2,2-trifluoroethylamino)benzenecarboximidamide |
| SMILES | N/C(=N\NCC(F)(F)F)c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C15H21F3N4/c16-15(17,18)11-20-21-14(19)13-6-4-12(5-7-13)10-22-8-2-1-3-9-22/h4-7,20H,1-3,8-11H2,(H2,19,21) |
| InChIKey | GEHCEJPPWUMZRQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|