C20H23F2N4O2+ — CID 165138951
(2S,4R)-N-[(R)-(2-amino-3-pyridinyl)-(3-fluoro-4-propan-2-ylphenyl)methyl]-4-fluoro-1-oxopyrrolidin-1-ium-2-carboxamide (PubChem CID 165138951) has the molecular formula C20H23F2N4O2+ and a molecular weight of 389.43 g/mol. Its IUPAC name is (2S,4R)-N-[(R)-(2-amino-3-pyridinyl)-(3-fluoro-4-propan-2-ylphenyl)methyl]-4-fluoro-1-oxopyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2S,4R)-N-[(R)-(2-amino-3-pyridinyl)-(3-fluoro-4-propan-2-ylphenyl)methyl]-4-fluoro-1-oxopyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165138951 |
| Molecular Formula | C20H23F2N4O2+ |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2S,4R)-N-[(R)-(2-amino-3-pyridinyl)-(3-fluoro-4-propan-2-ylphenyl)methyl]-4-fluoro-1-oxopyrrolidin-1-ium-2-carboxamide |
| SMILES | CC(C)c1ccc([C@@H](NC(=O)[C@@H]2C[C@@H](F)C[N+]2=O)c2cccnc2N)cc1F |
| InChI | InChI=1S/C20H22F2N4O2/c1-11(2)14-6-5-12(8-16(14)22)18(15-4-3-7-24-19(15)23)25-20(27)17-9-13(21)10-26(17)28/h3-8,11,13,17-18H,9-10H2,1-2H3,(H2-,23,24,25,27)/p+1/t13-,17+,18-/m1/s1 |
| InChIKey | AUOYLMVJECFHTF-JEBQAFNWSA-O |
| XLogP | 3.02 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|