C24H30F3N6O2+ — CID 171097552
[(Z)-4-[(2S,4R)-4-fluoro-2-[[(3-fluoro-4-propan-2-ylphenyl)-(5-fluoro-3-pyridinyl)methyl]carbamoyl]pyrrolidin-1-yl]-2-hydrazinyl-4-oxobut-1-enyl]azanium (PubChem CID 171097552) has the molecular formula C24H30F3N6O2+ and a molecular weight of 491.54 g/mol. Its IUPAC name is [(Z)-4-[(2S,4R)-4-fluoro-2-[[(3-fluoro-4-propan-2-ylphenyl)-(5-fluoro-3-pyridinyl)methyl]carbamoyl]pyrrolidin-1-yl]-2-hydrazinyl-4-oxobut-1-enyl]azanium.
| Compound Name | [(Z)-4-[(2S,4R)-4-fluoro-2-[[(3-fluoro-4-propan-2-ylphenyl)-(5-fluoro-3-pyridinyl)methyl]carbamoyl]pyrrolidin-1-yl]-2-hydrazinyl-4-oxobut-1-enyl]azanium |
|---|---|
| PubChem CID | 171097552 |
| Molecular Formula | C24H30F3N6O2+ |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | [(Z)-4-[(2S,4R)-4-fluoro-2-[[(3-fluoro-4-propan-2-ylphenyl)-(5-fluoro-3-pyridinyl)methyl]carbamoyl]pyrrolidin-1-yl]-2-hydrazinyl-4-oxobut-1-enyl]azanium |
| SMILES | CC(C)c1ccc(C(NC(=O)[C@@H]2C[C@@H](F)CN2C(=O)C/C(=C/[NH3+])NN)c2cncc(F)c2)cc1F |
| InChI | InChI=1S/C24H29F3N6O2/c1-13(2)19-4-3-14(6-20(19)27)23(15-5-16(25)11-30-10-15)31-24(35)21-7-17(26)12-33(21)22(34)8-18(9-28)32-29/h3-6,9-11,13,17,21,23,32H,7-8,12,28-29H2,1-2H3,(H,31,35)/p+1/b18-9-/t17-,21+,23?/m1/s1 |
| InChIKey | JFLRQOUUXXEMFP-BVZOQGDTSA-O |
| XLogP | 1.56 |
| TPSA | 127.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|