C26H31F4N5O2 — CID 174321620
(2S,4R)-1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-4-fluoro-N-[phenyl-[4-propan-2-yl-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 174321620) has the molecular formula C26H31F4N5O2 and a molecular weight of 521.56 g/mol. Its IUPAC name is (2S,4R)-1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-4-fluoro-N-[phenyl-[4-propan-2-yl-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-4-fluoro-N-[phenyl-[4-propan-2-yl-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174321620 |
| Molecular Formula | C26H31F4N5O2 |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (2S,4R)-1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-4-fluoro-N-[phenyl-[4-propan-2-yl-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)c1ccc(C(NC(=O)[C@@H]2C[C@@H](F)CN2C(=O)C/C(=C/N)NN)c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H31F4N5O2/c1-15(2)20-9-8-17(10-21(20)26(28,29)30)24(16-6-4-3-5-7-16)33-25(37)22-11-18(27)14-35(22)23(36)12-19(13-31)34-32/h3-10,13,15,18,22,24,34H,11-12,14,31-32H2,1-2H3,(H,33,37)/b19-13-/t18-,22+,24?/m1/s1 |
| InChIKey | AFULHHSUMLZDDP-LBSQHXPWSA-N |
| XLogP | 3.63 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|