About 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen
3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen (PubChem CID 165139144) has the molecular formula C8H16F2N2O
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen |
| PubChem CID | 165139144 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen |
| SMILES | CC(C)CNC(=O)N1CC(F)(F)C1.[H][H] |
| InChI | InChI=1S/C8H14F2N2O.H2/c1-6(2)3-11-7(13)12-4-8(9,10)5-12;/h6H,3-5H2,1-2H3,(H,11,13);1H |
| InChIKey | YGOQZKMSIDTKAM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen?
The IUPAC name of 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen (CID 165139144) is 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen.
What is the SMILES notation for 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen?
The canonical SMILES for 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen is CC(C)CNC(=O)N1CC(F)(F)C1.[H][H].
What is the InChIKey of 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen?
The InChIKey is YGOQZKMSIDTKAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O.H2/c1-6(2)3-11-7(13)12-4-8(9,10)5-12;/h6H,3-5H2,1-2H3,(H,11,13);1H.
What are the key properties of 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen?
3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen has a molecular weight of 194.23 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-N-(2-methylpropyl)azetidine-1-carboxamide;molecular hydrogen is sourced from PubChem (CID 165139144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).