C8H14F2N2O — CID 122269479
N-tert-butyl-3,3-difluoroazetidine-1-carboxamide (PubChem CID 122269479) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluoroazetidine-1-carboxamide.
| Compound Name | N-tert-butyl-3,3-difluoroazetidine-1-carboxamide |
|---|---|
| PubChem CID | 122269479 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N-tert-butyl-3,3-difluoroazetidine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H14F2N2O/c1-7(2,3)11-6(13)12-4-8(9,10)5-12/h4-5H2,1-3H3,(H,11,13) |
| InChIKey | ZBPXAMCKWVOFNS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |