About N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide
N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide (PubChem CID 167134973) has the molecular formula C8H14F2N2O
and a molecular weight of 192.21 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide |
| PubChem CID | 167134973 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H14F2N2O/c1-3-6(2)11-7(13)12-4-8(9,10)5-12/h6H,3-5H2,1-2H3,(H,11,13)/t6-/m1/s1 |
| InChIKey | DDUYUDVEDKNIEX-ZCFIWIBFSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide?
The IUPAC name of N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide (CID 167134973) is N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide.
What is the SMILES notation for N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide?
The canonical SMILES for N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide is CC[C@@H](C)NC(=O)N1CC(F)(F)C1.
What is the InChIKey of N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide?
The InChIKey is DDUYUDVEDKNIEX-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14F2N2O/c1-3-6(2)11-7(13)12-4-8(9,10)5-12/h6H,3-5H2,1-2H3,(H,11,13)/t6-/m1/s1.
What are the key properties of N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide?
N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide has a molecular weight of 192.21 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide is sourced from PubChem (CID 167134973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).