C8H14F2N2O — CID 167134973
N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide (PubChem CID 167134973) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide |
|---|---|
| PubChem CID | 167134973 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3,3-difluoroazetidine-1-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H14F2N2O/c1-3-6(2)11-7(13)12-4-8(9,10)5-12/h6H,3-5H2,1-2H3,(H,11,13)/t6-/m1/s1 |
| InChIKey | DDUYUDVEDKNIEX-ZCFIWIBFSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |