C13H22F6N2O — CID 3433139
3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,1-bis(2-methylpropyl)urea (PubChem CID 3433139) has the molecular formula C13H22F6N2O and a molecular weight of 336.32 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,1-bis(2-methylpropyl)urea.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,1-bis(2-methylpropyl)urea |
|---|---|
| PubChem CID | 3433139 |
| Molecular Formula | C13H22F6N2O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,1-bis(2-methylpropyl)urea |
| SMILES | CC(C)CN(CC(C)C)C(=O)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H22F6N2O/c1-8(2)6-21(7-9(3)4)10(22)20-11(5,12(14,15)16)13(17,18)19/h8-9H,6-7H2,1-5H3,(H,20,22) |
| InChIKey | IFKMGFACGFGOKZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |