C24H29F2N7O3 — CID 165139223
(2S,4R)-1-[(2S)-2-amino-2-[[amino(methyl)carbamoyl]amino]acetyl]-N-[(S)-(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 165139223) has the molecular formula C24H29F2N7O3 and a molecular weight of 501.54 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-amino-2-[[amino(methyl)carbamoyl]amino]acetyl]-N-[(S)-(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-amino-2-[[amino(methyl)carbamoyl]amino]acetyl]-N-[(S)-(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 165139223 |
| Molecular Formula | C24H29F2N7O3 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-amino-2-[[amino(methyl)carbamoyl]amino]acetyl]-N-[(S)-(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CN(N)C(=O)N[C@H](N)C(=O)N1C[C@H](F)C[C@H]1C(=O)N[C@@H](c1ccccc1)c1ccc(C2CC2)c(F)n1 |
| InChI | InChI=1S/C24H29F2N7O3/c1-32(28)24(36)31-21(27)23(35)33-12-15(25)11-18(33)22(34)30-19(14-5-3-2-4-6-14)17-10-9-16(13-7-8-13)20(26)29-17/h2-6,9-10,13,15,18-19,21H,7-8,11-12,27-28H2,1H3,(H,30,34)(H,31,36)/t15-,18+,19+,21+/m1/s1 |
| InChIKey | DKDFCPYEIBOKLX-CCMRYFRJSA-N |
| XLogP | 1.04 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|