C27H34F2N6O2 — CID 171097572
1-[2-[amino-[(Z)-2-(propan-2-ylamino)ethenyl]amino]acetyl]-N-[(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 171097572) has the molecular formula C27H34F2N6O2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-[2-[amino-[(Z)-2-(propan-2-ylamino)ethenyl]amino]acetyl]-N-[(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[amino-[(Z)-2-(propan-2-ylamino)ethenyl]amino]acetyl]-N-[(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 171097572 |
| Molecular Formula | C27H34F2N6O2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 1-[2-[amino-[(Z)-2-(propan-2-ylamino)ethenyl]amino]acetyl]-N-[(5-cyclopropyl-6-fluoro-2-pyridinyl)-phenylmethyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CC(C)N/C=C\N(N)CC(=O)N1CC(F)CC1C(=O)NC(c1ccccc1)c1ccc(C2CC2)c(F)n1 |
| InChI | InChI=1S/C27H34F2N6O2/c1-17(2)31-12-13-34(30)16-24(36)35-15-20(28)14-23(35)27(37)33-25(19-6-4-3-5-7-19)22-11-10-21(18-8-9-18)26(29)32-22/h3-7,10-13,17-18,20,23,25,31H,8-9,14-16,30H2,1-2H3,(H,33,37)/b13-12- |
| InChIKey | LCCLEZJSZZAQAR-SEYXRHQNSA-N |
| XLogP | 2.89 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|