C21H28FN3O2 — CID 165139722
tert-butyl N-[[3-[amino-(6-fluoro-5-propan-2-yl-2-pyridinyl)methyl]phenyl]methyl]carbamate (PubChem CID 165139722) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is tert-butyl N-[[3-[amino-(6-fluoro-5-propan-2-yl-2-pyridinyl)methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[amino-(6-fluoro-5-propan-2-yl-2-pyridinyl)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 165139722 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | tert-butyl N-[[3-[amino-(6-fluoro-5-propan-2-yl-2-pyridinyl)methyl]phenyl]methyl]carbamate |
| SMILES | CC(C)c1ccc(C(N)c2cccc(CNC(=O)OC(C)(C)C)c2)nc1F |
| InChI | InChI=1S/C21H28FN3O2/c1-13(2)16-9-10-17(25-19(16)22)18(23)15-8-6-7-14(11-15)12-24-20(26)27-21(3,4)5/h6-11,13,18H,12,23H2,1-5H3,(H,24,26) |
| InChIKey | KCCNQXZNFMJPSY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|