About ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen
ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen (PubChem CID 165141938) has the molecular formula C15H27FN2
and a molecular weight of 254.39 g/mol. Its IUPAC name is ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen |
| PubChem CID | 165141938 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen |
| SMILES | CC.CCN[C@@H]1CCN[C@H](c2ccc(F)cc2)C1.[H][H] |
| InChI | InChI=1S/C13H19FN2.C2H6.H2/c1-2-15-12-7-8-16-13(9-12)10-3-5-11(14)6-4-10;1-2;/h3-6,12-13,15-16H,2,7-9H2,1H3;1-2H3;1H/t12-,13+;;/m1../s1 |
| InChIKey | VFURDBLRYAVXMB-VAALMUBNSA-N |
| XLogP | 3.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
The IUPAC name of ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen (CID 165141938) is ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen.
What is the SMILES notation for ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
The canonical SMILES for ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen is CC.CCN[C@@H]1CCN[C@H](c2ccc(F)cc2)C1.[H][H].
What is the InChIKey of ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
The InChIKey is VFURDBLRYAVXMB-VAALMUBNSA-N. The full InChI is InChI=1S/C13H19FN2.C2H6.H2/c1-2-15-12-7-8-16-13(9-12)10-3-5-11(14)6-4-10;1-2;/h3-6,12-13,15-16H,2,7-9H2,1H3;1-2H3;1H/t12-,13+;;/m1../s1.
What are the key properties of ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen has a molecular weight of 254.39 g/mol, XLogP of 3.50, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2S,4R)-N-ethyl-2-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen is sourced from PubChem (CID 165141938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).