C13H17F2N3O — CID 22615440
2-[[2-(2,4-difluorophenyl)piperidin-4-yl]amino]acetamide (PubChem CID 22615440) has the molecular formula C13H17F2N3O and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[[2-(2,4-difluorophenyl)piperidin-4-yl]amino]acetamide.
| Compound Name | 2-[[2-(2,4-difluorophenyl)piperidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 22615440 |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[[2-(2,4-difluorophenyl)piperidin-4-yl]amino]acetamide |
| SMILES | NC(=O)CNC1CCNC(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C13H17F2N3O/c14-8-1-2-10(11(15)5-8)12-6-9(3-4-17-12)18-7-13(16)19/h1-2,5,9,12,17-18H,3-4,6-7H2,(H2,16,19) |
| InChIKey | XLTUHOORTOAGOX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |