C17H25FN2O2 — CID 69217621
butyl N-[(2R,4S)-2-(4-fluoro-2-methylphenyl)piperidin-4-yl]carbamate (PubChem CID 69217621) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is butyl N-[(2R,4S)-2-(4-fluoro-2-methylphenyl)piperidin-4-yl]carbamate.
| Compound Name | butyl N-[(2R,4S)-2-(4-fluoro-2-methylphenyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69217621 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | butyl N-[(2R,4S)-2-(4-fluoro-2-methylphenyl)piperidin-4-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@H]1CCN[C@@H](c2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C17H25FN2O2/c1-3-4-9-22-17(21)20-14-7-8-19-16(11-14)15-6-5-13(18)10-12(15)2/h5-6,10,14,16,19H,3-4,7-9,11H2,1-2H3,(H,20,21)/t14-,16+/m0/s1 |
| InChIKey | VAICDRQWUUKRJD-GOEBONIOSA-N |
| XLogP | 3.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|