C30H39F3N2O2S — CID 165143489
2,3-dimethyloct-2-ene;6-[(E)-2-methylbut-2-enoyl]-N-[3-(trifluoromethyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 165143489) has the molecular formula C30H39F3N2O2S and a molecular weight of 548.72 g/mol. Its IUPAC name is 2,3-dimethyloct-2-ene;6-[(E)-2-methylbut-2-enoyl]-N-[3-(trifluoromethyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2,3-dimethyloct-2-ene;6-[(E)-2-methylbut-2-enoyl]-N-[3-(trifluoromethyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165143489 |
| Molecular Formula | C30H39F3N2O2S |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 2,3-dimethyloct-2-ene;6-[(E)-2-methylbut-2-enoyl]-N-[3-(trifluoromethyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | C/C=C(\C)C(=O)N1CCc2c(C(=O)Nc3cccc(C(F)(F)F)c3)csc2C1.CCCCCC(C)=C(C)C |
| InChI | InChI=1S/C20H19F3N2O2S.C10H20/c1-3-12(2)19(27)25-8-7-15-16(11-28-17(15)10-25)18(26)24-14-6-4-5-13(9-14)20(21,22)23;1-5-6-7-8-10(4)9(2)3/h3-6,9,11H,7-8,10H2,1-2H3,(H,24,26);5-8H2,1-4H3/b12-3+; |
| InChIKey | AMVGQRLJEWGGBC-QXKVDVGOSA-N |
| XLogP | 8.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|