C23H24F4N2O — CID 165144108
N-[(6-ethylisoquinolin-5-yl)methyl]cyclobutanamine;4-fluoro-3-(trifluoromethyl)phenol (PubChem CID 165144108) has the molecular formula C23H24F4N2O and a molecular weight of 420.45 g/mol. Its IUPAC name is N-[(6-ethylisoquinolin-5-yl)methyl]cyclobutanamine;4-fluoro-3-(trifluoromethyl)phenol.
| Compound Name | N-[(6-ethylisoquinolin-5-yl)methyl]cyclobutanamine;4-fluoro-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 165144108 |
| Molecular Formula | C23H24F4N2O |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(6-ethylisoquinolin-5-yl)methyl]cyclobutanamine;4-fluoro-3-(trifluoromethyl)phenol |
| SMILES | CCc1ccc2cnccc2c1CNC1CCC1.Oc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20N2.C7H4F4O/c1-2-12-6-7-13-10-17-9-8-15(13)16(12)11-18-14-4-3-5-14;8-6-2-1-4(12)3-5(6)7(9,10)11/h6-10,14,18H,2-5,11H2,1H3;1-3,12H |
| InChIKey | YPAYUZUTMDNPMX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |