C20H25FN2O3 — CID 165145218
tert-butyl N-[2-[[2-fluoro-3-(hydroxymethyl)-4-methylanilino]methyl]phenyl]carbamate (PubChem CID 165145218) has the molecular formula C20H25FN2O3 and a molecular weight of 360.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-fluoro-3-(hydroxymethyl)-4-methylanilino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-fluoro-3-(hydroxymethyl)-4-methylanilino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 165145218 |
| Molecular Formula | C20H25FN2O3 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | tert-butyl N-[2-[[2-fluoro-3-(hydroxymethyl)-4-methylanilino]methyl]phenyl]carbamate |
| SMILES | Cc1ccc(NCc2ccccc2NC(=O)OC(C)(C)C)c(F)c1CO |
| InChI | InChI=1S/C20H25FN2O3/c1-13-9-10-17(18(21)15(13)12-24)22-11-14-7-5-6-8-16(14)23-19(25)26-20(2,3)4/h5-10,22,24H,11-12H2,1-4H3,(H,23,25) |
| InChIKey | NSTSMYNJENMTAC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |