C10H11ClO2 — CID 165145782
(8-chloro-3,4-dihydro-1H-isochromen-4-yl)methanol (PubChem CID 165145782) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is (8-chloro-3,4-dihydro-1H-isochromen-4-yl)methanol.
| Compound Name | (8-chloro-3,4-dihydro-1H-isochromen-4-yl)methanol |
|---|---|
| PubChem CID | 165145782 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (8-chloro-3,4-dihydro-1H-isochromen-4-yl)methanol |
| SMILES | OCC1COCc2c(Cl)cccc21 |
| InChI | InChI=1S/C10H11ClO2/c11-10-3-1-2-8-7(4-12)5-13-6-9(8)10/h1-3,7,12H,4-6H2 |
| InChIKey | QBZHQPFIJLUJRZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |