C22H40O4Pd — CID 165147382
palladium;bis(2,3,4,4-tetramethylhept-2-enoic acid) (PubChem CID 165147382) has the molecular formula C22H40O4Pd and a molecular weight of 474.98 g/mol. Its IUPAC name is palladium;bis(2,3,4,4-tetramethylhept-2-enoic acid).
| Compound Name | palladium;bis(2,3,4,4-tetramethylhept-2-enoic acid) |
|---|---|
| PubChem CID | 165147382 |
| Molecular Formula | C22H40O4Pd |
| Molecular Weight | 474.98 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | palladium;bis(2,3,4,4-tetramethylhept-2-enoic acid) |
| SMILES | CCCC(C)(C)C(C)=C(C)C(=O)O.CCCC(C)(C)C(C)=C(C)C(=O)O.[Pd] |
| InChI | InChI=1S/2C11H20O2.Pd/c2*1-6-7-11(4,5)9(3)8(2)10(12)13;/h2*6-7H2,1-5H3,(H,12,13); |
| InChIKey | IAPQVDIHHPRPMR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.98 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|