C53H44F3N3O3S — CID 165148309
[2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate (PubChem CID 165148309) has the molecular formula C53H44F3N3O3S and a molecular weight of 860.01 g/mol. Its IUPAC name is [2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165148309 |
| Molecular Formula | C53H44F3N3O3S |
| Molecular Weight | 860.01 g/mol |
| Exact Mass | 859.31 |
| IUPAC Name | [2-[2-[3,5-bis[2-[4-(5-methyl-2-pyridinyl)phenyl]ethyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(-c2ccc(CCc3cc(CCc4ccc(-c5ccc(C)cn5)cc4)cc(-c4ccccc4-c4ccc(-c5ccc(C)cn5)cc4OS(=O)(=O)C(F)(F)F)c3)cc2)nc1 |
| InChI | InChI=1S/C53H44F3N3O3S/c1-35-8-25-49(57-32-35)42-19-15-38(16-20-42)11-13-40-28-41(14-12-39-17-21-43(22-18-39)50-26-9-36(2)33-58-50)30-45(29-40)46-6-4-5-7-47(46)48-24-23-44(51-27-10-37(3)34-59-51)31-52(48)62-63(60,61)53(54,55)56/h4-10,15-34H,11-14H2,1-3H3 |
| InChIKey | SVLLLZXTERVVMQ-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.01 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|