C58H41N3O — CID 166806244
2-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenol (PubChem CID 166806244) has the molecular formula C58H41N3O and a molecular weight of 795.99 g/mol. Its IUPAC name is 2-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenol.
| Compound Name | 2-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenol |
|---|---|
| PubChem CID | 166806244 |
| Molecular Formula | C58H41N3O |
| Molecular Weight | 795.99 g/mol |
| Exact Mass | 795.32 |
| IUPAC Name | 2-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]-5-(5-methyl-2-pyridinyl)phenol |
| SMILES | Cc1ccc(-c2ccc(-c3ccccc3-c3cc(-c4ccccc4-c4ccc(-c5ccccn5)cc4)cc(-c4ccccc4-c4ccc(-c5ccccn5)cc4)c3)c(O)c2)nc1 |
| InChI | InChI=1S/C58H41N3O/c1-39-20-31-57(61-38-39)44-29-30-54(58(62)37-44)53-17-7-6-16-52(53)47-35-45(50-14-4-2-12-48(50)40-21-25-42(26-22-40)55-18-8-10-32-59-55)34-46(36-47)51-15-5-3-13-49(51)41-23-27-43(28-24-41)56-19-9-11-33-60-56/h2-38,62H,1H3 |
| InChIKey | MMXYXHFKPQFKFN-UHFFFAOYSA-N |
| XLogP | 14.89 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.99 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |