C64H47F3IrN3 — CID 165148397
5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-[4-[3-(3,3,3-trifluoropropyl)phenyl]phenyl]pyridine;iridium(3+) (PubChem CID 165148397) has the molecular formula C64H47F3IrN3 and a molecular weight of 1107.31 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-[4-[3-(3,3,3-trifluoropropyl)phenyl]phenyl]pyridine;iridium(3+).
| Compound Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-[4-[3-(3,3,3-trifluoropropyl)phenyl]phenyl]pyridine;iridium(3+) |
|---|---|
| PubChem CID | 165148397 |
| Molecular Formula | C64H47F3IrN3 |
| Molecular Weight | 1107.31 g/mol |
| Exact Mass | 1107.34 |
| IUPAC Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-[4-[3-(3,3,3-trifluoropropyl)phenyl]phenyl]pyridine;iridium(3+) |
| SMILES | FC(F)(F)CCc1cccc(-c2ccc(-c3cc(-c4[c-]cccc4)ncc3-c3ccccc3-c3cc(CCc4ccc(-c5[c-]cccc5)nc4)cc(CCc4ccc(-c5[c-]cccc5)nc4)c3)cc2)c1.[Ir+3] |
| InChI | InChI=1S/C64H47F3N3.Ir/c65-64(66,67)36-35-45-13-12-20-55(38-45)50-29-31-51(32-30-50)59-41-63(54-18-8-3-9-19-54)70-44-60(59)58-22-11-10-21-57(58)56-39-48(25-23-46-27-33-61(68-42-46)52-14-4-1-5-15-52)37-49(40-56)26-24-47-28-34-62(69-43-47)53-16-6-2-7-17-53;/h1-14,16,18,20-22,27-34,37-44H,23-26,35-36H2;/q-3;+3 |
| InChIKey | VDRGSEJMHSFIOG-UHFFFAOYSA-N |
| XLogP | 16.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.31 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|