C49H39N3O — CID 165149434
5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-1H-pyridin-4-one (PubChem CID 165149434) has the molecular formula C49H39N3O and a molecular weight of 685.87 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-1H-pyridin-4-one.
| Compound Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 165149434 |
| Molecular Formula | C49H39N3O |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-1H-pyridin-4-one |
| SMILES | O=c1cc(-c2ccccc2)[nH]cc1-c1ccccc1-c1cc(CCc2ccc(-c3ccccc3)nc2)cc(CCc2ccc(-c3ccccc3)nc2)c1 |
| InChI | InChI=1S/C49H39N3O/c53-49-31-48(41-16-8-3-9-17-41)52-34-45(49)44-19-11-10-18-43(44)42-29-37(22-20-35-24-26-46(50-32-35)39-12-4-1-5-13-39)28-38(30-42)23-21-36-25-27-47(51-33-36)40-14-6-2-7-15-40/h1-19,24-34H,20-23H2,(H,52,53) |
| InChIKey | ANPFNMXNEQQIOU-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |